C16H18Cl2N2O2 — CID 24795573
2-(2,4-dichloroanilino)-7-methyl-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 24795573) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-7-methyl-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 2-(2,4-dichloroanilino)-7-methyl-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 24795573 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-(2,4-dichloroanilino)-7-methyl-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | CC1CCCC2(CC(=O)N(Nc3ccc(Cl)cc3Cl)C2=O)C1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c1-10-3-2-6-16(8-10)9-14(21)20(15(16)22)19-13-5-4-11(17)7-12(13)18/h4-5,7,10,19H,2-3,6,8-9H2,1H3 |
| InChIKey | KMPYMLCZTFQZON-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|