C18H14N6O2S — CID 24795582
3-(1H-indol-3-ylmethyl)-4-[(E)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 24795582) has the molecular formula C18H14N6O2S and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-4-[(E)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1H-indol-3-ylmethyl)-4-[(E)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 24795582 |
| Molecular Formula | C18H14N6O2S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-4-[(E)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1ccc(/C=N/n2c(Cc3c[nH]c4ccccc34)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H14N6O2S/c25-24(26)14-7-5-12(6-8-14)10-20-23-17(21-22-18(23)27)9-13-11-19-16-4-2-1-3-15(13)16/h1-8,10-11,19H,9H2,(H,22,27)/b20-10+ |
| InChIKey | RVXVSOOTCMKXEA-KEBDBYFISA-N |
| XLogP | 3.80 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|