C33H37NO6 — CID 24795632
(5S,6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-5-phenylmethoxypiperidin-2-one (PubChem CID 24795632) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is (5S,6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-5-phenylmethoxypiperidin-2-one.
| Compound Name | (5S,6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-5-phenylmethoxypiperidin-2-one |
|---|---|
| PubChem CID | 24795632 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (5S,6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-5-phenylmethoxypiperidin-2-one |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3[C@@H](OCc4ccccc4)CCC(=O)N3Cc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C33H37NO6/c1-33(2)39-31-30(37-22-25-16-10-5-11-17-25)29(38-32(31)40-33)28-26(36-21-24-14-8-4-9-15-24)18-19-27(35)34(28)20-23-12-6-3-7-13-23/h3-17,26,28-32H,18-22H2,1-2H3/t26-,28-,29+,30-,31+,32+/m0/s1 |
| InChIKey | DVGOINROMLPDHY-CAAKUEANSA-N |
| XLogP | 5.22 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |