C26H31NO5 — CID 24795770
(6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidin-2-one (PubChem CID 24795770) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidin-2-one.
| Compound Name | (6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidin-2-one |
|---|---|
| PubChem CID | 24795770 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (6S)-6-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidin-2-one |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3CCCC(=O)N3Cc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C26H31NO5/c1-26(2)31-24-23(29-17-19-12-7-4-8-13-19)22(30-25(24)32-26)20-14-9-15-21(28)27(20)16-18-10-5-3-6-11-18/h3-8,10-13,20,22-25H,9,14-17H2,1-2H3/t20-,22+,23-,24+,25+/m0/s1 |
| InChIKey | REHPUILGKYDJAG-ULUWBBDRSA-N |
| XLogP | 4.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |