C22H27N3O11 — CID 24796132
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(E)-(carbamoylhydrazinylidene)methyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 24796132) has the molecular formula C22H27N3O11 and a molecular weight of 509.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(E)-(carbamoylhydrazinylidene)methyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(E)-(carbamoylhydrazinylidene)methyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24796132 |
| Molecular Formula | C22H27N3O11 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(E)-(carbamoylhydrazinylidene)methyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(/C=N/NC(N)=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H27N3O11/c1-11(26)31-10-17-18(32-12(2)27)19(33-13(3)28)20(34-14(4)29)21(36-17)35-16-7-5-15(6-8-16)9-24-25-22(23)30/h5-9,17-21H,10H2,1-4H3,(H3,23,25,30)/b24-9+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | SDIVRLWVOYZOBH-YAEWTXORSA-N |
| XLogP | 0.15 |
| TPSA | 191.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|