C17H20BF5S — CID 24796342
fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium tetrafluoroborate (PubChem CID 24796342) has the molecular formula C17H20BF5S and a molecular weight of 362.22 g/mol. Its IUPAC name is fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium tetrafluoroborate.
| Compound Name | fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium tetrafluoroborate |
|---|---|
| PubChem CID | 24796342 |
| Molecular Formula | C17H20BF5S |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium tetrafluoroborate |
| SMILES | Cc1cc([S+](CF)c2ccccc2)c(C)c(C)c1C.F[B-](F)(F)F |
| InChI | InChI=1S/C17H20FS.BF4/c1-12-10-17(15(4)14(3)13(12)2)19(11-18)16-8-6-5-7-9-16;2-1(3,4)5/h5-10H,11H2,1-4H3;/q+1;-1 |
| InChIKey | SDWOHFZFPMIYRL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|