C17H20FS+ — CID 24796343
fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium (PubChem CID 24796343) has the molecular formula C17H20FS+ and a molecular weight of 275.41 g/mol. Its IUPAC name is fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium.
| Compound Name | fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
|---|---|
| PubChem CID | 24796343 |
| Molecular Formula | C17H20FS+ |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | fluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
| SMILES | Cc1cc([S+](CF)c2ccccc2)c(C)c(C)c1C |
| InChI | InChI=1S/C17H20FS/c1-12-10-17(15(4)14(3)13(12)2)19(11-18)16-8-6-5-7-9-16/h5-10H,11H2,1-4H3/q+1 |
| InChIKey | DWHKSVIBOKNYOK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|