C11H17FO6 — CID 24796347
triethyl 2-fluoroethane-1,1,1-tricarboxylate (PubChem CID 24796347) has the molecular formula C11H17FO6 and a molecular weight of 264.25 g/mol. Its IUPAC name is triethyl 2-fluoroethane-1,1,1-tricarboxylate.
| Compound Name | triethyl 2-fluoroethane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 24796347 |
| Molecular Formula | C11H17FO6 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | triethyl 2-fluoroethane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(CF)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C11H17FO6/c1-4-16-8(13)11(7-12,9(14)17-5-2)10(15)18-6-3/h4-7H2,1-3H3 |
| InChIKey | CFORAZUBFXATJO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|