C27H53N3O12P2 — CID 24796367
[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [hydroxy(phenylmethoxy)phosphoryl] hydrogen phosphate;bis(N,N-diethylethanamine) (PubChem CID 24796367) has the molecular formula C27H53N3O12P2 and a molecular weight of 673.68 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [hydroxy(phenylmethoxy)phosphoryl] hydrogen phosphate;bis(N,N-diethylethanamine).
| Compound Name | [(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [hydroxy(phenylmethoxy)phosphoryl] hydrogen phosphate;bis(N,N-diethylethanamine) |
|---|---|
| PubChem CID | 24796367 |
| Molecular Formula | C27H53N3O12P2 |
| Molecular Weight | 673.68 g/mol |
| Exact Mass | 673.31 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [hydroxy(phenylmethoxy)phosphoryl] hydrogen phosphate;bis(N,N-diethylethanamine) |
| SMILES | CC(=O)N[C@H]1[C@@H](OP(=O)(O)OP(=O)(O)OCc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O.CCN(CC)CC.CCN(CC)CC |
| InChI | InChI=1S/C15H23NO12P2.2C6H15N/c1-9(18)16-12-14(20)13(19)11(7-17)26-15(12)27-30(23,24)28-29(21,22)25-8-10-5-3-2-4-6-10;2*1-4-7(5-2)6-3/h2-6,11-15,17,19-20H,7-8H2,1H3,(H,16,18)(H,21,22)(H,23,24);2*4-6H2,1-3H3/t11-,12-,13-,14-,15-;;/m1../s1 |
| InChIKey | IXAPOHVDVIQUII-HDLULPCASA-N |
| XLogP | 2.08 |
| TPSA | 207.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|