C8H9F9N2O2S — CID 24796609
1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3S)-pyrrolidin-3-yl]butane-1-sulfonamide (PubChem CID 24796609) has the molecular formula C8H9F9N2O2S and a molecular weight of 368.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3S)-pyrrolidin-3-yl]butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3S)-pyrrolidin-3-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 24796609 |
| Molecular Formula | C8H9F9N2O2S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3S)-pyrrolidin-3-yl]butane-1-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCNC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9N2O2S/c9-5(10,7(13,14)15)6(11,12)8(16,17)22(20,21)19-4-1-2-18-3-4/h4,18-19H,1-3H2/t4-/m0/s1 |
| InChIKey | RQHCRHFKBPVPMJ-BYPYZUCNSA-N |
| XLogP | 1.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|