About N-decylsulfamate
N-decylsulfamate (PubChem CID 24796778) has the molecular formula C10H22NO3S-
and a molecular weight of 236.36 g/mol. Its IUPAC name is N-decylsulfamate.
Molecular Properties
| Compound Name | N-decylsulfamate |
| PubChem CID | 24796778 |
| Molecular Formula | C10H22NO3S- |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-decylsulfamate |
| SMILES | CCCCCCCCCCNS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H23NO3S/c1-2-3-4-5-6-7-8-9-10-11-15(12,13)14/h11H,2-10H2,1H3,(H,12,13,14)/p-1 |
| InChIKey | YTVRFBQKVFJIQD-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-decylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decylsulfamate?
The IUPAC name of N-decylsulfamate (CID 24796778) is N-decylsulfamate.
What is the SMILES notation for N-decylsulfamate?
The canonical SMILES for N-decylsulfamate is CCCCCCCCCCNS(=O)(=O)[O-].
What is the InChIKey of N-decylsulfamate?
The InChIKey is YTVRFBQKVFJIQD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H23NO3S/c1-2-3-4-5-6-7-8-9-10-11-15(12,13)14/h11H,2-10H2,1H3,(H,12,13,14)/p-1.
What are the key properties of N-decylsulfamate?
N-decylsulfamate has a molecular weight of 236.36 g/mol, XLogP of 2.18, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-decylsulfamate is sourced from PubChem (CID 24796778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).