About 9-methyldecylsulfamic acid
9-methyldecylsulfamic acid (PubChem CID 24796785) has the molecular formula C11H25NO3S
and a molecular weight of 251.39 g/mol. Its IUPAC name is 9-methyldecylsulfamic acid.
Molecular Properties
| Compound Name | 9-methyldecylsulfamic acid |
| PubChem CID | 24796785 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 9-methyldecylsulfamic acid |
| SMILES | CC(C)CCCCCCCCNS(=O)(=O)O |
| InChI | InChI=1S/C11H25NO3S/c1-11(2)9-7-5-3-4-6-8-10-12-16(13,14)15/h11-12H,3-10H2,1-2H3,(H,13,14,15) |
| InChIKey | GAYAKNYWWOBJHZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldecylsulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldecylsulfamic acid?
The IUPAC name of 9-methyldecylsulfamic acid (CID 24796785) is 9-methyldecylsulfamic acid.
What is the SMILES notation for 9-methyldecylsulfamic acid?
The canonical SMILES for 9-methyldecylsulfamic acid is CC(C)CCCCCCCCNS(=O)(=O)O.
What is the InChIKey of 9-methyldecylsulfamic acid?
The InChIKey is GAYAKNYWWOBJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO3S/c1-11(2)9-7-5-3-4-6-8-10-12-16(13,14)15/h11-12H,3-10H2,1-2H3,(H,13,14,15).
What are the key properties of 9-methyldecylsulfamic acid?
9-methyldecylsulfamic acid has a molecular weight of 251.39 g/mol, XLogP of 2.77, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldecylsulfamic acid is sourced from PubChem (CID 24796785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).