C14H24O3 — CID 24796888
(E,2S)-5-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol (PubChem CID 24796888) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (E,2S)-5-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol.
| Compound Name | (E,2S)-5-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 24796888 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (E,2S)-5-[(4R,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol |
| SMILES | C=CCC[C@@H]1OC(C)(C)O[C@@H]1/C=C/C[C@H](C)O |
| InChI | InChI=1S/C14H24O3/c1-5-6-9-12-13(10-7-8-11(2)15)17-14(3,4)16-12/h5,7,10-13,15H,1,6,8-9H2,2-4H3/b10-7+/t11-,12-,13+/m0/s1 |
| InChIKey | OVIYPDRUMDENLC-PUJUQVOMSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|