About 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene
1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene (PubChem CID 24797) has the molecular formula C30H28O4
and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene.
Molecular Properties
| Compound Name | 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene |
| PubChem CID | 24797 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene |
| SMILES | COc1ccc(C(=C(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H28O4/c1-31-25-13-5-21(6-14-25)29(22-7-15-26(32-2)16-8-22)30(23-9-17-27(33-3)18-10-23)24-11-19-28(34-4)20-12-24/h5-20H,1-4H3 |
| InChIKey | LXYBRRVOIQFRRL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene?
The IUPAC name of 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene (CID 24797) is 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene.
What is the SMILES notation for 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene?
The canonical SMILES for 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene is COc1ccc(C(=C(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene?
The InChIKey is LXYBRRVOIQFRRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28O4/c1-31-25-13-5-21(6-14-25)29(22-7-15-26(32-2)16-8-22)30(23-9-17-27(33-3)18-10-23)24-11-19-28(34-4)20-12-24/h5-20H,1-4H3.
What are the key properties of 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene?
1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene has a molecular weight of 452.55 g/mol, XLogP of 6.73, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene is sourced from PubChem (CID 24797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).