C26H23NO3 — CID 24797825
3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoic acid (PubChem CID 24797825) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoic acid.
| Compound Name | 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 24797825 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoic acid |
| SMILES | Cc1c(-c2ccccc2)cc(-c2ccccc2)n1-c1ccc(OCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H23NO3/c1-19-24(20-8-4-2-5-9-20)18-25(21-10-6-3-7-11-21)27(19)22-12-14-23(15-13-22)30-17-16-26(28)29/h2-15,18H,16-17H2,1H3,(H,28,29) |
| InChIKey | KCSSWAMXQNJYBR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|