C16H25N5 — CID 24798232
4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-6-cyclopentylpyrimidin-2-amine (PubChem CID 24798232) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-6-cyclopentylpyrimidin-2-amine.
| Compound Name | 4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-6-cyclopentylpyrimidin-2-amine |
|---|---|
| PubChem CID | 24798232 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-6-cyclopentylpyrimidin-2-amine |
| SMILES | Nc1nc(C2CCCC2)cc(N2C[C@H]3CCCN[C@H]3C2)n1 |
| InChI | InChI=1S/C16H25N5/c17-16-19-13(11-4-1-2-5-11)8-15(20-16)21-9-12-6-3-7-18-14(12)10-21/h8,11-12,14,18H,1-7,9-10H2,(H2,17,19,20)/t12-,14+/m1/s1 |
| InChIKey | IJGBPZUPXXTBBG-OCCSQVGLSA-N |
| XLogP | 1.90 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |