C20H18N6O — CID 24798665
N-[5-(2-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridin-3-ylpropanamide (PubChem CID 24798665) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[5-(2-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[5-(2-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 24798665 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[5-(2-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-pyridin-3-ylpropanamide |
| SMILES | Nc1ccccc1-c1cccc2nc(NC(=O)CCc3cccnc3)nn12 |
| InChI | InChI=1S/C20H18N6O/c21-16-7-2-1-6-15(16)17-8-3-9-18-23-20(25-26(17)18)24-19(27)11-10-14-5-4-12-22-13-14/h1-9,12-13H,10-11,21H2,(H,24,25,27) |
| InChIKey | LBOIOOMUZAGXLR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|