About 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one
1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one (PubChem CID 24798925) has the molecular formula C33H26Br2N2O
and a molecular weight of 626.39 g/mol. Its IUPAC name is 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one.
Molecular Properties
| Compound Name | 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one |
| PubChem CID | 24798925 |
| Molecular Formula | C33H26Br2N2O |
| Molecular Weight | 626.39 g/mol |
| Exact Mass | 624.04 |
| IUPAC Name | 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one |
| SMILES | O=C(CC(c1ccc(Br)cc1)c1c[nH]c2ccccc12)CC(c1ccc(Br)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C33H26Br2N2O/c34-23-13-9-21(10-14-23)28(30-19-36-32-7-3-1-5-26(30)32)17-25(38)18-29(22-11-15-24(35)16-12-22)31-20-37-33-8-4-2-6-27(31)33/h1-16,19-20,28-29,36-37H,17-18H2 |
| InChIKey | VNGULNLLGKUJLT-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.39 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one?
The IUPAC name of 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one (CID 24798925) is 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one.
What is the SMILES notation for 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one?
The canonical SMILES for 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one is O=C(CC(c1ccc(Br)cc1)c1c[nH]c2ccccc12)CC(c1ccc(Br)cc1)c1c[nH]c2ccccc12.
What is the InChIKey of 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one?
The InChIKey is VNGULNLLGKUJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H26Br2N2O/c34-23-13-9-21(10-14-23)28(30-19-36-32-7-3-1-5-26(30)32)17-25(38)18-29(22-11-15-24(35)16-12-22)31-20-37-33-8-4-2-6-27(31)33/h1-16,19-20,28-29,36-37H,17-18H2.
What are the key properties of 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one?
1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one has a molecular weight of 626.39 g/mol, XLogP of 9.49, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(4-bromophenyl)-1,5-bis(1H-indol-3-yl)pentan-3-one is sourced from PubChem (CID 24798925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).