C17H11N3O5 — CID 24799349
13-hydroxy-4,6-dimethyl-4,6,8-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1,7,9,12(17),13,15-hexaene-3,5,11,18-tetrone (PubChem CID 24799349) has the molecular formula C17H11N3O5 and a molecular weight of 337.29 g/mol. Its IUPAC name is 13-hydroxy-4,6-dimethyl-4,6,8-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1,7,9,12(17),13,15-hexaene-3,5,11,18-tetrone.
| Compound Name | 13-hydroxy-4,6-dimethyl-4,6,8-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1,7,9,12(17),13,15-hexaene-3,5,11,18-tetrone |
|---|---|
| PubChem CID | 24799349 |
| Molecular Formula | C17H11N3O5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 13-hydroxy-4,6-dimethyl-4,6,8-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1,7,9,12(17),13,15-hexaene-3,5,11,18-tetrone |
| SMILES | Cn1c(=O)c2c3c(cnc2n(C)c1=O)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C17H11N3O5/c1-19-15-12(16(24)20(2)17(19)25)11-8(6-18-15)14(23)10-7(13(11)22)4-3-5-9(10)21/h3-6,21H,1-2H3 |
| InChIKey | KGCFXHNQGJRPDI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|