C23H23N3O4 — CID 24799617
trans-(1R,2R)-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 24799617) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 24799617 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | trans-(1R,2R)-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | CNC(=O)[C@]1(c2cccc(OCc3cc(C)nc4ccccc34)c2)C[C@H]1C(=O)NO |
| InChI | InChI=1S/C23H23N3O4/c1-14-10-15(18-8-3-4-9-20(18)25-14)13-30-17-7-5-6-16(11-17)23(22(28)24-2)12-19(23)21(27)26-29/h3-11,19,29H,12-13H2,1-2H3,(H,24,28)(H,26,27)/t19-,23-/m0/s1 |
| InChIKey | AHGWEVJBCPZWCU-CVDCTZTESA-N |
| XLogP | 2.63 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|