C30H29N3O4 — CID 24799620
trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 24799620) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 24799620 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-N-methyl-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | Cc1cc(COc2cccc([C@@]3(C(=O)N(C)Cc4ccccc4)C[C@H]3C(=O)NO)c2)c2ccccc2n1 |
| InChI | InChI=1S/C30H29N3O4/c1-20-15-22(25-13-6-7-14-27(25)31-20)19-37-24-12-8-11-23(16-24)30(17-26(30)28(34)32-36)29(35)33(2)18-21-9-4-3-5-10-21/h3-16,26,36H,17-19H2,1-2H3,(H,32,34)/t26-,30-/m0/s1 |
| InChIKey | HHOVOSIJHJQMCK-YZNIXAGQSA-N |
| XLogP | 4.54 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|