About 2-trityl-4,5-dihydro-1,3-oxazole
2-trityl-4,5-dihydro-1,3-oxazole (PubChem CID 24799664) has the molecular formula C22H19NO
and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-trityl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-trityl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 24799664 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-trityl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(C(C2=NCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO/c1-4-10-18(11-5-1)22(21-23-16-17-24-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | PHFOYYZFWZIUBU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-trityl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trityl-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-trityl-4,5-dihydro-1,3-oxazole (CID 24799664) is 2-trityl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-trityl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-trityl-4,5-dihydro-1,3-oxazole is c1ccc(C(C2=NCCO2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-trityl-4,5-dihydro-1,3-oxazole?
The InChIKey is PHFOYYZFWZIUBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO/c1-4-10-18(11-5-1)22(21-23-16-17-24-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2.
What are the key properties of 2-trityl-4,5-dihydro-1,3-oxazole?
2-trityl-4,5-dihydro-1,3-oxazole has a molecular weight of 313.40 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trityl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 24799664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).