C22H36O7 — CID 24799687
(9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl) 2-methyl-3-oxopentanoate (PubChem CID 24799687) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is (9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl) 2-methyl-3-oxopentanoate.
| Compound Name | (9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl) 2-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 24799687 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl) 2-methyl-3-oxopentanoate |
| SMILES | CCC(=O)C(C)C(=O)OC(C(C)C(=O)CC)C(C)C(=O)C(C)C(CC)OC(C)=O |
| InChI | InChI=1S/C22H36O7/c1-9-17(24)12(4)21(29-22(27)13(5)18(25)10-2)15(7)20(26)14(6)19(11-3)28-16(8)23/h12-15,19,21H,9-11H2,1-8H3 |
| InChIKey | BXPUQZCMXTUGDK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|