C27H30N4O4 — CID 24799777
trans-(1R,2R)-N-hydroxy-2-(4-methylpiperazine-1-carbonyl)-2-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1-carboxamide (PubChem CID 24799777) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is trans-(1R,2R)-N-hydroxy-2-(4-methylpiperazine-1-carbonyl)-2-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-hydroxy-2-(4-methylpiperazine-1-carbonyl)-2-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 24799777 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | trans-(1R,2R)-N-hydroxy-2-(4-methylpiperazine-1-carbonyl)-2-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1cc(COc2cccc([C@@]3(C(=O)N4CCN(C)CC4)C[C@H]3C(=O)NO)c2)c2ccccc2n1 |
| InChI | InChI=1S/C27H30N4O4/c1-18-14-19(22-8-3-4-9-24(22)28-18)17-35-21-7-5-6-20(15-21)27(16-23(27)25(32)29-34)26(33)31-12-10-30(2)11-13-31/h3-9,14-15,23,34H,10-13,16-17H2,1-2H3,(H,29,32)/t23-,27-/m0/s1 |
| InChIKey | XACGDVHRXILWLO-HOFKKMOUSA-N |
| XLogP | 2.66 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|