C16H18N2O4 — CID 24799957
cis-(1R,2S)-1-[(4-but-2-ynoxyphenyl)methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide (PubChem CID 24799957) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is cis-(1R,2S)-1-[(4-but-2-ynoxyphenyl)methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-1-[(4-but-2-ynoxyphenyl)methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 24799957 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | cis-(1R,2S)-1-[(4-but-2-ynoxyphenyl)methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
| SMILES | CC#CCOc1ccc(C[C@]2(C(N)=O)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C16H18N2O4/c1-2-3-8-22-12-6-4-11(5-7-12)9-16(15(17)20)10-13(16)14(19)18-21/h4-7,13,21H,8-10H2,1H3,(H2,17,20)(H,18,19)/t13-,16+/m1/s1 |
| InChIKey | XSYMYTAWKURPCI-CJNGLKHVSA-N |
| XLogP | 0.63 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|