C19H26F3N3O3S — CID 24800049
N-[2-[[(1R,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]acetamide (PubChem CID 24800049) has the molecular formula C19H26F3N3O3S and a molecular weight of 433.50 g/mol. Its IUPAC name is N-[2-[[(1R,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]acetamide.
| Compound Name | N-[2-[[(1R,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]acetamide |
|---|---|
| PubChem CID | 24800049 |
| Molecular Formula | C19H26F3N3O3S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[2-[[(1R,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethyl]acetamide |
| SMILES | CC(=O)NCCS(=O)(=O)N1[C@@H]2CC[C@@H]1CC(C(N)Cc1cc(F)c(F)cc1F)C2 |
| InChI | InChI=1S/C19H26F3N3O3S/c1-11(26)24-4-5-29(27,28)25-14-2-3-15(25)7-13(6-14)19(23)9-12-8-17(21)18(22)10-16(12)20/h8,10,13-15,19H,2-7,9,23H2,1H3,(H,24,26)/t14-,15-,19?/m1/s1 |
| InChIKey | LJEUYPKVJVFEEU-YCQNMSHMSA-N |
| XLogP | 1.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|