C16H16FNO6S — CID 2480010
methyl 2-[(2-fluorophenyl)sulfonylamino]-4,5-dimethoxybenzoate (PubChem CID 2480010) has the molecular formula C16H16FNO6S and a molecular weight of 369.37 g/mol. Its IUPAC name is methyl 2-[(2-fluorophenyl)sulfonylamino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(2-fluorophenyl)sulfonylamino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2480010 |
| Molecular Formula | C16H16FNO6S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | methyl 2-[(2-fluorophenyl)sulfonylamino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C16H16FNO6S/c1-22-13-8-10(16(19)24-3)12(9-14(13)23-2)18-25(20,21)15-7-5-4-6-11(15)17/h4-9,18H,1-3H3 |
| InChIKey | SARXRUBVXFPWNF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |