C22H32N4O3 — CID 24800127
6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl nitrate (PubChem CID 24800127) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl nitrate.
| Compound Name | 6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl nitrate |
|---|---|
| PubChem CID | 24800127 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 6-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propylamino]hexyl nitrate |
| SMILES | O=[N+]([O-])OCCCCCCNCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C22H32N4O3/c27-26(28)29-17-8-2-1-7-14-23-15-9-16-24-22-18-10-3-5-12-20(18)25-21-13-6-4-11-19(21)22/h3,5,10,12,23H,1-2,4,6-9,11,13-17H2,(H,24,25) |
| InChIKey | KDYGCIXCFTVKNZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|