C23H34N4O3 — CID 24800298
6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl nitrate (PubChem CID 24800298) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl nitrate.
| Compound Name | 6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl nitrate |
|---|---|
| PubChem CID | 24800298 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 6-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]hexyl nitrate |
| SMILES | O=[N+]([O-])OCCCCCCNCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C23H34N4O3/c28-27(29)30-18-10-2-1-7-15-24-16-8-9-17-25-23-19-11-3-5-13-21(19)26-22-14-6-4-12-20(22)23/h3,5,11,13,24H,1-2,4,6-10,12,14-18H2,(H,25,26) |
| InChIKey | GWQSPHDARHMRIN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|