C19H35BN2O4 — CID 24800360
(2S,3R)-2-amino-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide (PubChem CID 24800360) has the molecular formula C19H35BN2O4 and a molecular weight of 366.31 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide |
|---|---|
| PubChem CID | 24800360 |
| Molecular Formula | C19H35BN2O4 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)[C@@H](C)O)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C19H35BN2O4/c1-10(2)7-15(22-17(24)16(21)11(3)23)20-25-14-9-12-8-13(18(12,4)5)19(14,6)26-20/h10-16,23H,7-9,21H2,1-6H3,(H,22,24)/t11-,12+,13+,14-,15+,16+,19+/m1/s1 |
| InChIKey | JJBDBQWKRVDVRP-VZDDTXQJSA-N |
| XLogP | 1.49 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|