C20H27BN2O5 — CID 24800361
[(1R)-1-[[(2S,3R)-3-hydroxy-2-(naphthalene-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 24800361) has the molecular formula C20H27BN2O5 and a molecular weight of 386.26 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-3-hydroxy-2-(naphthalene-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-(naphthalene-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 24800361 |
| Molecular Formula | C20H27BN2O5 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-(naphthalene-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1ccc2ccccc2c1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C20H27BN2O5/c1-12(2)10-17(21(27)28)22-20(26)18(13(3)24)23-19(25)16-9-8-14-6-4-5-7-15(14)11-16/h4-9,11-13,17-18,24,27-28H,10H2,1-3H3,(H,22,26)(H,23,25)/t13-,17+,18+/m1/s1 |
| InChIKey | TURMTQOERGSAFV-BVGQSLNGSA-N |
| XLogP | 0.86 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|