About (5S,8R)-5,8-dihydroxydodec-6-ynoic acid
(5S,8R)-5,8-dihydroxydodec-6-ynoic acid (PubChem CID 24800367) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (5S,8R)-5,8-dihydroxydodec-6-ynoic acid.
Molecular Properties
| Compound Name | (5S,8R)-5,8-dihydroxydodec-6-ynoic acid |
| PubChem CID | 24800367 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (5S,8R)-5,8-dihydroxydodec-6-ynoic acid |
| SMILES | CCCC[C@@H](O)C#C[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C12H20O4/c1-2-3-5-10(13)8-9-11(14)6-4-7-12(15)16/h10-11,13-14H,2-7H2,1H3,(H,15,16)/t10-,11+/m1/s1 |
| InChIKey | FFERRNKFKPTEJW-MNOVXSKESA-N |
| XLogP | 1.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5S,8R)-5,8-dihydroxydodec-6-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,8R)-5,8-dihydroxydodec-6-ynoic acid?
The IUPAC name of (5S,8R)-5,8-dihydroxydodec-6-ynoic acid (CID 24800367) is (5S,8R)-5,8-dihydroxydodec-6-ynoic acid.
What is the SMILES notation for (5S,8R)-5,8-dihydroxydodec-6-ynoic acid?
The canonical SMILES for (5S,8R)-5,8-dihydroxydodec-6-ynoic acid is CCCC[C@@H](O)C#C[C@@H](O)CCCC(=O)O.
What is the InChIKey of (5S,8R)-5,8-dihydroxydodec-6-ynoic acid?
The InChIKey is FFERRNKFKPTEJW-MNOVXSKESA-N. The full InChI is InChI=1S/C12H20O4/c1-2-3-5-10(13)8-9-11(14)6-4-7-12(15)16/h10-11,13-14H,2-7H2,1H3,(H,15,16)/t10-,11+/m1/s1.
What are the key properties of (5S,8R)-5,8-dihydroxydodec-6-ynoic acid?
(5S,8R)-5,8-dihydroxydodec-6-ynoic acid has a molecular weight of 228.29 g/mol, XLogP of 1.16, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,8R)-5,8-dihydroxydodec-6-ynoic acid is sourced from PubChem (CID 24800367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).