About 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide
2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide (PubChem CID 24800409) has the molecular formula C27H32ClN3O
and a molecular weight of 450.03 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide |
| PubChem CID | 24800409 |
| Molecular Formula | C27H32ClN3O |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide |
| SMILES | O=C(NC1CCCCC1)C(C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C27H32ClN3O/c28-21-17-15-20(16-18-21)26-30-23-13-7-8-14-24(23)31(26)25(19-9-3-1-4-10-19)27(32)29-22-11-5-2-6-12-22/h7-8,13-19,22,25H,1-6,9-12H2,(H,29,32) |
| InChIKey | DZGNRZLPMHOISU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide?
The IUPAC name of 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide (CID 24800409) is 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide.
What is the SMILES notation for 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide?
The canonical SMILES for 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide is O=C(NC1CCCCC1)C(C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2ccccc21.
What is the InChIKey of 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide?
The InChIKey is DZGNRZLPMHOISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32ClN3O/c28-21-17-15-20(16-18-21)26-30-23-13-7-8-14-24(23)31(26)25(19-9-3-1-4-10-19)27(32)29-22-11-5-2-6-12-22/h7-8,13-19,22,25H,1-6,9-12H2,(H,29,32).
What are the key properties of 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide?
2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide has a molecular weight of 450.03 g/mol, XLogP of 6.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)benzimidazol-1-yl]-N,2-dicyclohexylacetamide is sourced from PubChem (CID 24800409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).