C22H20N2O4 — CID 24800423
7-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine (PubChem CID 24800423) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 7-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24800423 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 7-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1cc(Nc2nc3cccc(-c4ccccc4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N2O4/c1-25-18-12-15(13-19(26-2)21(18)27-3)23-22-24-17-11-7-10-16(20(17)28-22)14-8-5-4-6-9-14/h4-13H,1-3H3,(H,23,24) |
| InChIKey | VCWXWVQQCDUJCG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |