C22H29BN2O5 — CID 24800540
[(1R)-1-[[(2S,3R)-3-hydroxy-2-[(3-phenylbenzoyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 24800540) has the molecular formula C22H29BN2O5 and a molecular weight of 412.30 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(3-phenylbenzoyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(3-phenylbenzoyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 24800540 |
| Molecular Formula | C22H29BN2O5 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(3-phenylbenzoyl)amino]butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)c1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C22H29BN2O5/c1-14(2)12-19(23(29)30)24-22(28)20(15(3)26)25-21(27)18-11-7-10-17(13-18)16-8-5-4-6-9-16/h4-11,13-15,19-20,26,29-30H,12H2,1-3H3,(H,24,28)(H,25,27)/t15-,19+,20+/m1/s1 |
| InChIKey | MEQCWJHKGFDFBD-XPGWFJOJSA-N |
| XLogP | 1.38 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|