About (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone
(4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone (PubChem CID 24800709) has the molecular formula C18H12N2O2
and a molecular weight of 288.31 g/mol. Its IUPAC name is (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone.
Molecular Properties
| Compound Name | (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone |
| PubChem CID | 24800709 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone |
| SMILES | O=C(c1ccc(O)cc1)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C18H12N2O2/c21-12-7-5-11(6-8-12)18(22)17-16-14(9-10-19-17)13-3-1-2-4-15(13)20-16/h1-10,20-21H |
| InChIKey | DISBVDLVVUJENS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone?
The IUPAC name of (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone (CID 24800709) is (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone.
What is the SMILES notation for (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone?
The canonical SMILES for (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone is O=C(c1ccc(O)cc1)c1nccc2c1[nH]c1ccccc12.
What is the InChIKey of (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone?
The InChIKey is DISBVDLVVUJENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2/c21-12-7-5-11(6-8-12)18(22)17-16-14(9-10-19-17)13-3-1-2-4-15(13)20-16/h1-10,20-21H.
What are the key properties of (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone?
(4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone has a molecular weight of 288.31 g/mol, XLogP of 3.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanone is sourced from PubChem (CID 24800709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).