C13H12ClFN2O — CID 24800976
7-chloro-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (PubChem CID 24800976) has the molecular formula C13H12ClFN2O and a molecular weight of 266.70 g/mol. Its IUPAC name is 7-chloro-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide.
| Compound Name | 7-chloro-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 24800976 |
| Molecular Formula | C13H12ClFN2O |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 7-chloro-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| SMILES | NC(=O)C1CCCc2c1[nH]c1cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C13H12ClFN2O/c14-9-5-11-8(4-10(9)15)6-2-1-3-7(13(16)18)12(6)17-11/h4-5,7,17H,1-3H2,(H2,16,18) |
| InChIKey | MRNSBIJFTZDEFD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |