C29H27N3O4 — CID 24801012
trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 24801012) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 24801012 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | trans-(1R,2R)-1-N-benzyl-2-N-hydroxy-1-[3-[(2-methylquinolin-4-yl)methoxy]phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | Cc1cc(COc2cccc([C@@]3(C(=O)NCc4ccccc4)C[C@H]3C(=O)NO)c2)c2ccccc2n1 |
| InChI | InChI=1S/C29H27N3O4/c1-19-14-21(24-12-5-6-13-26(24)31-19)18-36-23-11-7-10-22(15-23)29(16-25(29)27(33)32-35)28(34)30-17-20-8-3-2-4-9-20/h2-15,25,35H,16-18H2,1H3,(H,30,34)(H,32,33)/t25-,29-/m0/s1 |
| InChIKey | MNWRESBWEYCTLP-SVEHJYQDSA-N |
| XLogP | 4.20 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|