C19H22N8O4S — CID 24801018
1-[(E)-[6-(3,6-dimethoxy-2-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]-2-(propan-2-ylideneamino)guanidine (PubChem CID 24801018) has the molecular formula C19H22N8O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-[(E)-[6-(3,6-dimethoxy-2-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]-2-(propan-2-ylideneamino)guanidine.
| Compound Name | 1-[(E)-[6-(3,6-dimethoxy-2-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]-2-(propan-2-ylideneamino)guanidine |
|---|---|
| PubChem CID | 24801018 |
| Molecular Formula | C19H22N8O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-[(E)-[6-(3,6-dimethoxy-2-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]-2-(propan-2-ylideneamino)guanidine |
| SMILES | COc1ccc(OC)c([N+](=O)[O-])c1-c1nc2sc(C)cn2c1/C=N/N/C(N)=N\N=C(C)C |
| InChI | InChI=1S/C19H22N8O4S/c1-10(2)23-25-18(20)24-21-8-12-16(22-19-26(12)9-11(3)32-19)15-13(30-4)6-7-14(31-5)17(15)27(28)29/h6-9H,1-5H3,(H3,20,24,25)/b21-8+ |
| InChIKey | JNYBEEILJPIYER-ODCIPOBUSA-N |
| XLogP | 2.93 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|