C21H28F3N3O4S — CID 24801097
1-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-morpholin-4-ylsulfonylethanone (PubChem CID 24801097) has the molecular formula C21H28F3N3O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is 1-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-morpholin-4-ylsulfonylethanone.
| Compound Name | 1-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-morpholin-4-ylsulfonylethanone |
|---|---|
| PubChem CID | 24801097 |
| Molecular Formula | C21H28F3N3O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-morpholin-4-ylsulfonylethanone |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H28F3N3O4S/c22-17-11-19(24)18(23)9-13(17)10-20(25)14-7-15-1-2-16(8-14)27(15)21(28)12-32(29,30)26-3-5-31-6-4-26/h9,11,14-16,20H,1-8,10,12,25H2/t14?,15?,16?,20-/m1/s1 |
| InChIKey | PFYBOQNXSJHUST-KOXXJLNZSA-N |
| XLogP | 1.41 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|