About (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid
(Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid (PubChem CID 24801246) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid.
Molecular Properties
| Compound Name | (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid |
| PubChem CID | 24801246 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)CC[C@H]1CCC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,16,18H,2-3,5-6,8-15H2,1H3,(H,23,24)/b7-4-/t16-,18+/m0/s1 |
| InChIKey | PCNTYYZBVYGRNZ-BFVRRIQPSA-N |
| XLogP | 4.71 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid?
The IUPAC name of (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid (CID 24801246) is (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid.
What is the SMILES notation for (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid?
The canonical SMILES for (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid is CCCCCC(=O)CC[C@H]1CCC(=O)[C@@H]1C/C=C\CCCC(=O)O.
What is the InChIKey of (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid?
The InChIKey is PCNTYYZBVYGRNZ-BFVRRIQPSA-N. The full InChI is InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,16,18H,2-3,5-6,8-15H2,1H3,(H,23,24)/b7-4-/t16-,18+/m0/s1.
What are the key properties of (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid?
(Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid has a molecular weight of 336.47 g/mol, XLogP of 4.71, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-[(1R,5S)-2-oxo-5-(3-oxooctyl)cyclopentyl]hept-5-enoic acid is sourced from PubChem (CID 24801246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).