C26H43NO2 — CID 24801251
(2S)-N-tert-butyl-2-[(3S,5S,9R,10S,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide (PubChem CID 24801251) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-[(3S,5S,9R,10S,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide.
| Compound Name | (2S)-N-tert-butyl-2-[(3S,5S,9R,10S,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide |
|---|---|
| PubChem CID | 24801251 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | (2S)-N-tert-butyl-2-[(3S,5S,9R,10S,13R,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide |
| SMILES | C[C@H](C(=O)NC(C)(C)C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H43NO2/c1-16(23(29)27-24(2,3)4)20-9-10-21-19-8-7-17-15-18(28)11-13-25(17,5)22(19)12-14-26(20,21)6/h8,16-18,20-22,28H,7,9-15H2,1-6H3,(H,27,29)/t16-,17-,18-,20+,21-,22-,25-,26+/m0/s1 |
| InChIKey | ALCCHWTXVDKNGF-DTNFZNKOSA-N |
| XLogP | 5.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|