About tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate
tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate (PubChem CID 24801405) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate |
| PubChem CID | 24801405 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CO)(CO)C1 |
| InChI | InChI=1S/C10H19NO4/c1-9(2,3)15-8(14)11-4-10(5-11,6-12)7-13/h12-13H,4-7H2,1-3H3 |
| InChIKey | GAXAFYOXCGGDFH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate?
The IUPAC name of tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate (CID 24801405) is tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate?
The canonical SMILES for tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate is CC(C)(C)OC(=O)N1CC(CO)(CO)C1.
What is the InChIKey of tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate?
The InChIKey is GAXAFYOXCGGDFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-9(2,3)15-8(14)11-4-10(5-11,6-12)7-13/h12-13H,4-7H2,1-3H3.
What are the key properties of tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate?
tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate has a molecular weight of 217.26 g/mol, XLogP of 0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate is sourced from PubChem (CID 24801405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).