About 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one
4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one (PubChem CID 24801440) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one |
| PubChem CID | 24801440 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one |
| SMILES | Cc1cc(C)cc(OCC#CCOc2cc(=O)n(-c3ccccc3)c3ncccc23)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-19-15-20(2)17-22(16-19)30-13-6-7-14-31-24-18-25(29)28(21-9-4-3-5-10-21)26-23(24)11-8-12-27-26/h3-5,8-12,15-18H,13-14H2,1-2H3 |
| InChIKey | YVFDTCWZSFVUQY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one?
The IUPAC name of 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one (CID 24801440) is 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one.
What is the SMILES notation for 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one?
The canonical SMILES for 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one is Cc1cc(C)cc(OCC#CCOc2cc(=O)n(-c3ccccc3)c3ncccc23)c1.
What is the InChIKey of 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one?
The InChIKey is YVFDTCWZSFVUQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O3/c1-19-15-20(2)17-22(16-19)30-13-6-7-14-31-24-18-25(29)28(21-9-4-3-5-10-21)26-23(24)11-8-12-27-26/h3-5,8-12,15-18H,13-14H2,1-2H3.
What are the key properties of 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one?
4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one has a molecular weight of 410.47 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,5-dimethylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one is sourced from PubChem (CID 24801440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).