C21H19N3O4 — CID 24801650
7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine (PubChem CID 24801650) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24801650 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1cc(Nc2nc3cccc(-c4ccccn4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C21H19N3O4/c1-25-17-11-13(12-18(26-2)20(17)27-3)23-21-24-16-9-6-7-14(19(16)28-21)15-8-4-5-10-22-15/h4-12H,1-3H3,(H,23,24) |
| InChIKey | DEDZRYZURNCPPC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |