About Meriolin 4
Meriolin 4 (PubChem CID 24801697) has the molecular formula C13H13N5O
and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | Meriolin 4 |
| PubChem CID | 24801697 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | CCOC1=C2C(=CNC2=NC=C1)C3=NC(=NC=C3)N |
| InChI | InChI=1S/C13H13N5O/c1-2-19-10-4-6-15-12-11(10)8(7-17-12)9-3-5-16-13(14)18-9/h3-7H,2H2,1H3,(H,15,17)(H2,14,16,18) |
| InChIKey | CJJMNECGBUPMAV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | 303 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Meriolin 4 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Meriolin 4?
The IUPAC name of Meriolin 4 (CID 24801697) is 4-(4-ethoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine.
What is the SMILES notation for Meriolin 4?
The canonical SMILES for Meriolin 4 is CCOC1=C2C(=CNC2=NC=C1)C3=NC(=NC=C3)N.
What is the InChIKey of Meriolin 4?
The InChIKey is CJJMNECGBUPMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O/c1-2-19-10-4-6-15-12-11(10)8(7-17-12)9-3-5-16-13(14)18-9/h3-7H,2H2,1H3,(H,15,17)(H2,14,16,18).
What are the key properties of Meriolin 4?
Meriolin 4 has a molecular weight of 255.28 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Meriolin 4 is sourced from PubChem (CID 24801697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).