C22H34O4 — CID 24801756
[(1R,2S,3Z,5E,7S,10E,14S)-7-hydroxy-1,7,11-trimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-3,5,10-trien-2-yl] acetate (PubChem CID 24801756) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1R,2S,3Z,5E,7S,10E,14S)-7-hydroxy-1,7,11-trimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-3,5,10-trien-2-yl] acetate.
| Compound Name | [(1R,2S,3Z,5E,7S,10E,14S)-7-hydroxy-1,7,11-trimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-3,5,10-trien-2-yl] acetate |
|---|---|
| PubChem CID | 24801756 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1R,2S,3Z,5E,7S,10E,14S)-7-hydroxy-1,7,11-trimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-3,5,10-trien-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C(C(C)C)\C=C\[C@@](C)(O)CC/C=C(/C)CC[C@@H]2O[C@@]12C |
| InChI | InChI=1S/C22H34O4/c1-15(2)18-11-13-21(5,24)12-7-8-16(3)9-10-19-22(6,26-19)20(14-18)25-17(4)23/h8,11,13-15,19-20,24H,7,9-10,12H2,1-6H3/b13-11+,16-8-,18-14+/t19-,20-,21-,22+/m0/s1 |
| InChIKey | HVKLCFQGBOCFBB-AVLNBLAVSA-N |
| XLogP | 4.49 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|