C23H30F3N3O3 — CID 24801786
N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]oxane-4-carboxamide (PubChem CID 24801786) has the molecular formula C23H30F3N3O3 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]oxane-4-carboxamide.
| Compound Name | N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 24801786 |
| Molecular Formula | C23H30F3N3O3 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]oxane-4-carboxamide |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CNC(=O)C1CCOCC1 |
| InChI | InChI=1S/C23H30F3N3O3/c24-18-11-20(26)19(25)9-14(18)10-21(27)15-7-16-1-2-17(8-15)29(16)22(30)12-28-23(31)13-3-5-32-6-4-13/h9,11,13,15-17,21H,1-8,10,12,27H2,(H,28,31)/t15?,16?,17?,21-/m1/s1 |
| InChIKey | QYKRJNWKCFAKDN-TXRRYJPOSA-N |
| XLogP | 2.29 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|