About 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride
5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride (PubChem CID 24802270) has the molecular formula C8H8ClN3O2
and a molecular weight of 213.62 g/mol. Its IUPAC name is 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride |
| PubChem CID | 24802270 |
| Molecular Formula | C8H8ClN3O2 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride |
| SMILES | Cl.Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C8H7N3O2.ClH/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12;/h1-3H,9H2,(H,10,12)(H,11,13);1H |
| InChIKey | SCHUENIUEDOXQS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride?
The IUPAC name of 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride (CID 24802270) is 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride.
What is the SMILES notation for 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride?
The canonical SMILES for 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride is Cl.Nc1cccc2c(=O)[nH][nH]c(=O)c12.
What is the InChIKey of 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride?
The InChIKey is SCHUENIUEDOXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2.ClH/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12;/h1-3H,9H2,(H,10,12)(H,11,13);1H.
What are the key properties of 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride?
5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride has a molecular weight of 213.62 g/mol, XLogP of 0.22, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dihydrophthalazine-1,4-dione;hydrochloride is sourced from PubChem (CID 24802270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).