C17H22N4O — CID 24802721
12-methoxy-5,7-dimethyl-3-pentyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 24802721) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 12-methoxy-5,7-dimethyl-3-pentyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-methoxy-5,7-dimethyl-3-pentyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 24802721 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 12-methoxy-5,7-dimethyl-3-pentyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CCCCCc1nc(C)c2c(C)nc3ccc(OC)nc3n12 |
| InChI | InChI=1S/C17H22N4O/c1-5-6-7-8-14-19-12(3)16-11(2)18-13-9-10-15(22-4)20-17(13)21(14)16/h9-10H,5-8H2,1-4H3 |
| InChIKey | MFMGRWBSTBLPCH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|